Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
CNB1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7151±0.00919239 |
Normalized OD Score: sc h |
1.0346±0.00753942 |
Z-Score: |
1.2970±0.299182 |
p-Value: |
0.204554 |
Z-Factor: |
-1.00259 |
Fitness Defect: |
1.5869 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.80 Celcius | Date: | 2006-04-12 YYYY-MM-DD | Plate CH Control (+): | 0.039525000000000005±0.00142 | Plate DMSO Control (-): | 0.677±0.01215 | Plate Z-Factor: | 0.9370 |
| png ps pdf |
118112 |
3-(7,7-dimethyl-4-bicyclo[3.1.1]hept-3-enyl)-2,2-dimethyl-propanal |
213490 |
(8S,9R,10S,13R,14S,17S)-17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,14,15,16,17-dodecahydrocyclopenta[a]phe nanthren-3-one |
244126 |
17-acetyl-10,13-dimethyl-1,2,4,5,6,7,8,9,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-3-one |
297183 |
bicyclo[3.2.0]hept-3-en-7-one |
519382 |
4-(2,6,6-trimethyl-1-cyclohexenyl)butan-2-one |
546342 |
3-methyl-4-(2,6,6-trimethyl-1-cyclohexenyl)butan-2-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|