Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
KGD1 |
Replicates: |
2 |
Raw OD Value: r im |
0.7247±0.00417193 |
Normalized OD Score: sc h |
1.0191±0.00502822 |
Z-Score: |
1.1233±0.311762 |
p-Value: |
0.272812 |
Z-Factor: |
-3.73583 |
Fitness Defect: |
1.299 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-09-11 YYYY-MM-DD | Plate CH Control (+): | 0.0397±0.00049 | Plate DMSO Control (-): | 0.6979249999999999±0.01952 | Plate Z-Factor: | 0.9040 |
| png ps pdf |
6993841 |
(1S,5R)-bicyclo[3.2.0]hept-3-en-7-one |
7057322 |
(1S,5S)-bicyclo[3.2.1]oct-6-en-3-one |
7057323 |
(1R,5R)-bicyclo[3.2.1]oct-6-en-3-one |
7472015 |
(1S,5S)-bicyclo[3.2.0]hept-3-en-7-one |
7472016 |
(1R,5R)-bicyclo[3.2.0]hept-3-en-7-one |
11075295 |
n/a |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|