Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
RPN10 |
Replicates: |
2 |
Raw OD Value: r im |
0.6987±0.00799031 |
Normalized OD Score: sc h |
1.0349±0.00214273 |
Z-Score: |
1.7665±0.08382 |
p-Value: |
0.0778382 |
Z-Factor: |
-1.74455 |
Fitness Defect: |
2.5531 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.00 Celcius | Date: | 2007-09-28 YYYY-MM-DD | Plate CH Control (+): | 0.0411±0.00047 | Plate DMSO Control (-): | 0.67215±0.02560 | Plate Z-Factor: | 0.8856 |
| png ps pdf |
6437118 |
(4E)-cyclohexadec-4-en-1-one |
6438075 |
(4E)-3-methylcyclopentadec-4-en-1-one |
6442289 |
(1S,6Z,10R)-2,7,11,11-tetramethylbicyclo[8.1.0]undec-6-en-3-one |
6504767 |
(4E)-3-methylcyclopentadec-4-en-1-one |
6857764 |
(4E)-4,11,11-trimethylbicyclo[7.2.0]undec-4-en-8-one |
6993840 |
(1R,5S)-bicyclo[3.2.0]hept-3-en-7-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|