| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7269±0.00169706 |
| Normalized OD Score: sc h |
1.0239±0.00510908 |
| Z-Score: |
1.2946±0.258037 |
| p-Value: |
0.20287 |
| Z-Factor: |
-3.27389 |
| Fitness Defect: |
1.5952 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.50 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.04165±0.00070 | | Plate DMSO Control (-): | 0.691225±0.02158 | | Plate Z-Factor: | 0.8986 |
|  png
ps
pdf |
| 6437118 |
(4E)-cyclohexadec-4-en-1-one |
| 6438075 |
(4E)-3-methylcyclopentadec-4-en-1-one |
| 6442289 |
(1S,6Z,10R)-2,7,11,11-tetramethylbicyclo[8.1.0]undec-6-en-3-one |
| 6504767 |
(4E)-3-methylcyclopentadec-4-en-1-one |
| 6857764 |
(4E)-4,11,11-trimethylbicyclo[7.2.0]undec-4-en-8-one |
| 6993840 |
(1R,5S)-bicyclo[3.2.0]hept-3-en-7-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|
