Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
BY4741-3rd |
Replicates: |
2 |
Raw OD Value: r im |
0.6536±0.0103945 |
Normalized OD Score: sc h |
1.0073±0.00721443 |
Z-Score: |
0.9919±0.238546 |
p-Value: |
0.328112 |
Z-Factor: |
-3.44676 |
Fitness Defect: |
1.1144 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2007-09-25 YYYY-MM-DD | Plate CH Control (+): | 0.039575±0.00076 | Plate DMSO Control (-): | 0.643175±0.02819 | Plate Z-Factor: | 0.8611 |
| png ps pdf |
6422116 |
n/a |
6425057 |
n/a |
6428337 |
(8R,8aS)-8,8a-dimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-one |
6428365 |
(3S,8R,8aS)-3,8,8a-trimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-one |
6432867 |
(4E)-cyclodec-4-en-1-one |
6437002 |
2-[(E)-pent-2-enyl]cyclopentan-1-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|