| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
BY4741-2nd |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7936±0.00940452 |
| Normalized OD Score: sc h |
0.9920±0.000957312 |
| Z-Score: |
0.7946±0.0661025 |
| p-Value: |
0.427366 |
| Z-Factor: |
-3.13559 |
| Fitness Defect: |
0.8501 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 26.90 Celcius | | Date: | 2006-04-05 YYYY-MM-DD | | Plate CH Control (+): | 0.038349999999999995±0.00133 | | Plate DMSO Control (-): | 0.7598±0.02318 | | Plate Z-Factor: | 0.8681 |
|  png
ps
pdf |
| 6422116 |
n/a |
| 6425057 |
n/a |
| 6428337 |
(8R,8aS)-8,8a-dimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-one |
| 6428365 |
(3S,8R,8aS)-3,8,8a-trimethyl-1,3,4,6,7,8-hexahydronaphthalen-2-one |
| 6432867 |
(4E)-cyclodec-4-en-1-one |
| 6437002 |
2-[(E)-pent-2-enyl]cyclopentan-1-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|
