Compound Information | SONAR Target prediction | Name: | 15-NORCARYOPHYLLEN-3-ONE | Unique Identifier: | SPE00300166 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | C14H22O | Molecular Weight: | 184.149 g/mol | X log p: | 2.29 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | Source: | derivative |
Species: |
4932 |
Condition: |
IDH2 |
Replicates: |
2 |
Raw OD Value: r im |
0.5771±0.0185969 |
Normalized OD Score: sc h |
1.0226±0.0267125 |
Z-Score: |
1.1159±1.31087 |
p-Value: |
0.445592 |
Z-Factor: |
-6.01073 |
Fitness Defect: |
0.8084 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|C8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.80 Celcius | Date: | 2007-10-19 YYYY-MM-DD | Plate CH Control (+): | 0.040825±0.00061 | Plate DMSO Control (-): | 0.56835±0.01498 | Plate Z-Factor: | 0.9164 |
| png ps pdf |
5367850 |
2-[(E)-hex-2-enyl]cyclopentan-1-one |
5377548 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta [a]phenanthren-16-one |
5875489 |
(4Z)-cyclodec-4-en-1-one |
5993240 |
(4Z)-4,11,11-trimethylbicyclo[7.2.0]undec-4-en-8-one |
6365389 |
(4E)-cyclopentadec-4-en-1-one |
6374173 |
2-[(E)-6-methylhept-2-enyl]cyclohexan-1-one |
internal high similarity DBLink | Rows returned: 4 | |
active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|