| Compound Information | SONAR Target prediction | | Name: | 15-NORCARYOPHYLLEN-3-ONE | | Unique Identifier: | SPE00300166 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | C14H22O | | Molecular Weight: | 184.149 g/mol | | X log p: | 2.29 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1CCC2C(CC2(C)C)C(=O)CCC=1 | | Source: | derivative |
| Species: |
4932 |
| Condition: |
DCG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7186±0.000424264 |
| Normalized OD Score: sc h |
1.0212±0.000759265 |
| Z-Score: |
1.1701±0.0567329 |
| p-Value: |
0.24234 |
| Z-Factor: |
-2.20528 |
| Fitness Defect: |
1.4174 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|C8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.40 Celcius | | Date: | 2007-10-25 YYYY-MM-DD | | Plate CH Control (+): | 0.03975±0.00056 | | Plate DMSO Control (-): | 0.696025±0.02023 | | Plate Z-Factor: | 0.9010 |
| png ps pdf |
| 5367850 |
2-[(E)-hex-2-enyl]cyclopentan-1-one |
| 5377548 |
10,13-dimethyl-17-[(E)-6-methylhept-3-en-2-yl]-1,2,3,4,5,6,7,8,9,11,12,14,15,17-tetradecahydrocyclopenta [a]phenanthren-16-one |
| 5875489 |
(4Z)-cyclodec-4-en-1-one |
| 5993240 |
(4Z)-4,11,11-trimethylbicyclo[7.2.0]undec-4-en-8-one |
| 6365389 |
(4E)-cyclopentadec-4-en-1-one |
| 6374173 |
2-[(E)-6-methylhept-2-enyl]cyclohexan-1-one |
| internal high similarity DBLink | Rows returned: 4 | |
| active | Cluster 8140 | Additional Members: 2 | Rows returned: 1 | |
|