| Compound Information | SONAR Target prediction |  | Name: | CLOVANEDIOL DIACETATE |  | Unique Identifier: | SPE00300133  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 292.201 g/mol |  | X log p: | -0.016  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 52.6 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 4 |  | Rotatable Bond Count: | 4 |  | Canonical Smiles: | CC(=O)OC1CCC23CC1(C)CCC2C(C)(C)CC3OC(C)=O |  | Class: | sesquiterpene |  | Source: | derivative Dipterocarpus pilosus, Salvia canariensis, Viguiera oaxacana, Sindora sumatrana |  | Reference: | Chem Pharm Bull 42: 138 (1994) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		DCG1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.6928±0.00537401 | 
	 
	
		| Normalized OD Score: sc h | 
		0.9880±0.00713466 | 
	 
	
		| Z-Score: | 
		-0.6574±0.384684 | 
	 
	
		| p-Value: | 
		0.526332 | 
	 
	
		| Z-Factor: | 
		-19.4968 | 
	 
	
		| Fitness Defect: | 
		0.6418 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|C4 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.40 Celcius |  | Date: | 2007-10-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.03975±0.00056 |  | Plate DMSO Control (-): | 0.696025±0.02023 |  | Plate Z-Factor: | 0.9010 |  
  |  png ps pdf |  
 
 
	
		| 89263 | 
		[4-(2-acetyloxypropan-2-yl)-1-methyl-cyclohexyl] acetate | 
	 
	
		| 288371 | 
		(4b-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)methyl acetate | 
	 
	
		| 530262 | 
		[3,5-bis(acetyloxymethyl)cyclohexyl]methyl acetate | 
	 
	
		| 536437 | 
		[2-(3-hydroxypropyl)cyclohexyl] acetate | 
	 
	
		| 537176 | 
		(5-acetyloxycyclododecyl) acetate | 
	 
	
		| 538053 | 
		(5-acetyloxycyclooctyl) acetate | 
	 
 
 | internal high similarity DBLink  | Rows returned: 6 |  |   
 |  active | Cluster 4651 | Additional Members: 2 | Rows returned: 0 |  |  
  
 |