Compound Information | SONAR Target prediction | Name: | CLOVANEDIOL DIACETATE | Unique Identifier: | SPE00300133 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 292.201 g/mol | X log p: | -0.016 (online calculus) | Lipinksi Failures | 0 | TPSA | 52.6 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OC1CCC23CC1(C)CCC2C(C)(C)CC3OC(C)=O | Class: | sesquiterpene | Source: | derivative Dipterocarpus pilosus, Salvia canariensis, Viguiera oaxacana, Sindora sumatrana | Reference: | Chem Pharm Bull 42: 138 (1994) |
Species: |
4932 |
Condition: |
GIM4 |
Replicates: |
2 |
Raw OD Value: r im |
0.7099±0.00919239 |
Normalized OD Score: sc h |
1.0281±0.00449554 |
Z-Score: |
1.3043±0.192878 |
p-Value: |
0.196242 |
Z-Factor: |
-3.57016 |
Fitness Defect: |
1.6284 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.30 Celcius | Date: | 2008-03-20 YYYY-MM-DD | Plate CH Control (+): | 0.040675±0.00089 | Plate DMSO Control (-): | 0.706575±0.02694 | Plate Z-Factor: | 0.8769 |
| png ps pdf |
89263 |
[4-(2-acetyloxypropan-2-yl)-1-methyl-cyclohexyl] acetate |
288371 |
(4b-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)methyl acetate |
530262 |
[3,5-bis(acetyloxymethyl)cyclohexyl]methyl acetate |
536437 |
[2-(3-hydroxypropyl)cyclohexyl] acetate |
537176 |
(5-acetyloxycyclododecyl) acetate |
538053 |
(5-acetyloxycyclooctyl) acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 0 | |
|