Compound Information | SONAR Target prediction | Name: | CLOVANEDIOL DIACETATE | Unique Identifier: | SPE00300133 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 292.201 g/mol | X log p: | -0.016 (online calculus) | Lipinksi Failures | 0 | TPSA | 52.6 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OC1CCC23CC1(C)CCC2C(C)(C)CC3OC(C)=O | Class: | sesquiterpene | Source: | derivative Dipterocarpus pilosus, Salvia canariensis, Viguiera oaxacana, Sindora sumatrana | Reference: | Chem Pharm Bull 42: 138 (1994) |
Species: |
4932 |
Condition: |
GCN3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6627±0.00275772 |
Normalized OD Score: sc h |
0.9908±0.00310879 |
Z-Score: |
-0.4257±0.166599 |
p-Value: |
0.6725 |
Z-Factor: |
-3.6323 |
Fitness Defect: |
0.3968 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 22.40 Celcius | Date: | 2007-12-11 YYYY-MM-DD | Plate CH Control (+): | 0.042225±0.00066 | Plate DMSO Control (-): | 0.6512±0.01175 | Plate Z-Factor: | 0.9430 |
| png ps pdf |
89263 |
[4-(2-acetyloxypropan-2-yl)-1-methyl-cyclohexyl] acetate |
288371 |
(4b-hydroxy-1,4a-dimethyl-7-propan-2-yl-3,4,5,6,7,8,8a,9,10,10a-decahydro-2H-phenanthren-1-yl)methyl acetate |
530262 |
[3,5-bis(acetyloxymethyl)cyclohexyl]methyl acetate |
536437 |
[2-(3-hydroxypropyl)cyclohexyl] acetate |
537176 |
(5-acetyloxycyclododecyl) acetate |
538053 |
(5-acetyloxycyclooctyl) acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 0 | |
|