Compound Information | SONAR Target prediction | Name: | CLOVANEDIOL DIACETATE | Unique Identifier: | SPE00300133 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 292.201 g/mol | X log p: | -0.016 (online calculus) | Lipinksi Failures | 0 | TPSA | 52.6 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 4 | Rotatable Bond Count: | 4 | Canonical Smiles: | CC(=O)OC1CCC23CC1(C)CCC2C(C)(C)CC3OC(C)=O | Class: | sesquiterpene | Source: | derivative Dipterocarpus pilosus, Salvia canariensis, Viguiera oaxacana, Sindora sumatrana | Reference: | Chem Pharm Bull 42: 138 (1994) |
Species: |
4932 |
Condition: |
SPT3 |
Replicates: |
2 |
Raw OD Value: r im |
0.2430±0.00459619 |
Normalized OD Score: sc h |
0.5283±0.000463641 |
Z-Score: |
-7.6185±0.314387 |
p-Value: |
0.000000000000072333 |
Z-Factor: |
0.748416 |
Fitness Defect: |
30.2575 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 12|C2 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.80 Celcius | Date: | 2008-02-13 YYYY-MM-DD | Plate CH Control (+): | 0.0412±0.00185 | Plate DMSO Control (-): | 0.433±0.01661 | Plate Z-Factor: | 0.8650 |
| png ps pdf |
3471759 |
(11,16-diacetyloxy-13-methyl-1,2,3,4,5,6,7,8,9,10,11,12,14,15,16,17-hexadecahydrocyclopenta[a]phenanthre n-3-yl) acetate |
4108970 |
(7-hydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3 -yl) acetate |
4457488 |
n/a |
5166513 |
[7,12-diacetyloxy-17-(5-acetyloxy-5-methyl-hexan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17- tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate |
6420608 |
[8-(2-hydroxyethyl)-4,4,7,8-tetramethyl-decalin-1-yl] acetate |
6420612 |
2-(8-hydroxy-1,2,5,5-tetramethyl-decalin-1-yl)ethyl acetate |
internal high similarity DBLink | Rows returned: 6 | |
active | Cluster 4651 | Additional Members: 2 | Rows returned: 0 | |
|