| Compound Information | SONAR Target prediction | | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | | Unique Identifier: | SPE00300110 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 200.149 g/mol | | X log p: | -1.167 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | | Class: | sesquiterpene | | Source: | derivative Panax ginseng | | Reference: | Chem Pharm Bull 35: 1975 (1987) |
| Species: |
4932 |
| Condition: |
BCK1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6759±0.0151321 |
| Normalized OD Score: sc h |
1.0383±0.00487215 |
| Z-Score: |
1.8602±0.0623145 |
| p-Value: |
0.063107 |
| Z-Factor: |
-0.226385 |
| Fitness Defect: |
2.7629 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.50 Celcius | | Date: | 2006-03-24 YYYY-MM-DD | | Plate CH Control (+): | 0.03840000000000001±0.00118 | | Plate DMSO Control (-): | 0.6546±0.02444 | | Plate Z-Factor: | 0.8521 |
| png ps pdf |
| 1333 |
(10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium |
| 10570 |
(3S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthr en-17-one |
| 28539 |
4-hydroxy-4-methyl-cyclohexan-1-one |
| 36653 |
4-hydroxydecalin-1-one |
| 64184 |
5-hydroxyadamantan-2-one |
| 65529 |
(3R,8S,9S,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-17-one |
| internal high similarity DBLink | Rows returned: 3 | |
| nonactive | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|