| Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		DOC1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5499±0.0181019 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0086±0.00461325 | 
	 
	
		| Z-Score: | 
		0.3035±0.15862 | 
	 
	
		| p-Value: | 
		0.762958 | 
	 
	
		| Z-Factor: | 
		-11.4452 | 
	 
	
		| Fitness Defect: | 
		0.2706 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 9|G7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.30 Celcius |  | Date: | 2008-05-09 YYYY-MM-DD |  | Plate CH Control (+): | 0.04065±0.00055 |  | Plate DMSO Control (-): | 0.53425±0.01400 |  | Plate Z-Factor: | 0.8982 |  
  |  png ps pdf |  
 
 
	
		| 1333 | 
		(10-hydroxy-2,3,4,4a,5,6,7,8,8a,9a,10,10a-dodecahydro-1H-anthracen-9-ylidene)oxidanium | 
	 
	
		| 10570 | 
		(3S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthr en-17-one | 
	 
	
		| 28539 | 
		4-hydroxy-4-methyl-cyclohexan-1-one | 
	 
	
		| 36653 | 
		4-hydroxydecalin-1-one | 
	 
	
		| 64184 | 
		5-hydroxyadamantan-2-one | 
	 
	
		| 65529 | 
		(3R,8S,9S,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydro cyclopenta[a]phenanthren-17-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |