Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
CLB2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6912±0.0108187 |
Normalized OD Score: sc h |
1.0008±0.012358 |
Z-Score: |
0.0367±0.711467 |
p-Value: |
0.615144 |
Z-Factor: |
-41.1364 |
Fitness Defect: |
0.4859 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2007-11-02 YYYY-MM-DD | Plate CH Control (+): | 0.040650000000000006±0.00031 | Plate DMSO Control (-): | 0.6779999999999999±0.01990 | Plate Z-Factor: | 0.9077 |
| png ps pdf |
627599 |
6-hydroxy-10,13-dimethyl-2,4,5,6,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-dion e |
627689 |
6,17-dihydroxy-10,13-dimethyl-6-pentyl-2,4,5,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenant hren-3-one |
631915 |
n/a |
667488 |
(1R,3S)-5-hydroxyadamantan-2-one |
1712653 |
(2S,4R,5S)-4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |
2387089 |
1-[(5R,7S)-3-hydroxy-1-adamantyl]ethanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|