| Compound Information | SONAR Target prediction | | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | | Unique Identifier: | SPE00300110 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 200.149 g/mol | | X log p: | -1.167 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | | Class: | sesquiterpene | | Source: | derivative Panax ginseng | | Reference: | Chem Pharm Bull 35: 1975 (1987) |
| Species: |
4932 |
| Condition: |
PPH21 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7639±0.00883884 |
| Normalized OD Score: sc h |
1.0305±0.00829502 |
| Z-Score: |
1.0955±0.312586 |
| p-Value: |
0.284924 |
| Z-Factor: |
-2.43035 |
| Fitness Defect: |
1.2555 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.40 Celcius | | Date: | 2006-05-16 YYYY-MM-DD | | Plate CH Control (+): | 0.038225±0.00193 | | Plate DMSO Control (-): | 0.772425±0.02659 | | Plate Z-Factor: | 0.8599 |
| png ps pdf |
| 551583 |
4-hydroxy-3,3,5,5-tetramethyl-cyclohexan-1-one |
| 558961 |
1-(5-hydroxy-2,2,6-trimethyl-cyclohexyl)ethanone |
| 574055 |
5-hydroxy-4a-methyl-decalin-1-one |
| 574205 |
5-hydroxy-8a-methyl-decalin-1-one |
| 578149 |
4-(hydroxymethyl)adamantan-2-one |
| 591896 |
1-(3-hydroxy-1-adamantyl)ethanone |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|