Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
FUR4 |
Replicates: |
2 |
Raw OD Value: r im |
0.4371±0.0183848 |
Normalized OD Score: sc h |
0.9953±0.0108626 |
Z-Score: |
-0.0989±0.265216 |
p-Value: |
0.851956 |
Z-Factor: |
-9.19466 |
Fitness Defect: |
0.1602 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2006-03-22 YYYY-MM-DD | Plate CH Control (+): | 0.039075±0.00142 | Plate DMSO Control (-): | 0.437±0.00872 | Plate Z-Factor: | 0.9206 |
| png ps pdf |
551583 |
4-hydroxy-3,3,5,5-tetramethyl-cyclohexan-1-one |
558961 |
1-(5-hydroxy-2,2,6-trimethyl-cyclohexyl)ethanone |
574055 |
5-hydroxy-4a-methyl-decalin-1-one |
574205 |
5-hydroxy-8a-methyl-decalin-1-one |
578149 |
4-(hydroxymethyl)adamantan-2-one |
591896 |
1-(3-hydroxy-1-adamantyl)ethanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|