| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | BY4741 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.8175±0.0523966 |  
		| Normalized OD Score: sc h | 0.9880±0.00920007 |  
		| Z-Score: | 0.4927±0.405629 |  
		| p-Value: | 0.636266 |  
		| Z-Factor: | -5.51506 |  
		| Fitness Defect: | 0.4521 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum_ED |  | Plate Number and Position: | 21|G2 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 595 nm |  | Robot Temperature: | 30.00 Celcius |  | Date: | 2010-08-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.09625±0.00655 |  | Plate DMSO Control (-): | 0.9734999999999999±0.02029 |  | Plate Z-Factor: | 0.9078 | 
 |  png ps
 pdf
 | 
 
 
	
		| 551583 | 4-hydroxy-3,3,5,5-tetramethyl-cyclohexan-1-one |  
		| 558961 | 1-(5-hydroxy-2,2,6-trimethyl-cyclohexyl)ethanone |  
		| 574055 | 5-hydroxy-4a-methyl-decalin-1-one |  
		| 574205 | 5-hydroxy-8a-methyl-decalin-1-one |  
		| 578149 | 4-(hydroxymethyl)adamantan-2-one |  
		| 591896 | 1-(3-hydroxy-1-adamantyl)ethanone |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |