Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
RSA3 |
Replicates: |
2 |
Raw OD Value: r im |
0.6835±0.0257387 |
Normalized OD Score: sc h |
1.0130±0.00328354 |
Z-Score: |
0.5550±0.148011 |
p-Value: |
0.58099 |
Z-Factor: |
-6.22591 |
Fitness Defect: |
0.543 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.10 Celcius | Date: | 2008-04-01 YYYY-MM-DD | Plate CH Control (+): | 0.039675±0.00141 | Plate DMSO Control (-): | 0.675825±0.02015 | Plate Z-Factor: | 0.8789 |
| png ps pdf |
551583 |
4-hydroxy-3,3,5,5-tetramethyl-cyclohexan-1-one |
558961 |
1-(5-hydroxy-2,2,6-trimethyl-cyclohexyl)ethanone |
574055 |
5-hydroxy-4a-methyl-decalin-1-one |
574205 |
5-hydroxy-8a-methyl-decalin-1-one |
578149 |
4-(hydroxymethyl)adamantan-2-one |
591896 |
1-(3-hydroxy-1-adamantyl)ethanone |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|