Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
SWE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.6983±0.0137179 |
Normalized OD Score: sc h |
1.0130±0.00181426 |
Z-Score: |
1.4621±0.0646876 |
p-Value: |
0.144132 |
Z-Factor: |
-0.756598 |
Fitness Defect: |
1.937 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.90 Celcius | Date: | 2008-05-13 YYYY-MM-DD | Plate CH Control (+): | 0.040625±0.00043 | Plate DMSO Control (-): | 0.7051249999999999±0.01675 | Plate Z-Factor: | 0.9196 |
| png ps pdf |
428939 |
n/a |
428940 |
n/a |
495695 |
5-hydroxydecalin-1-one |
495837 |
n/a |
522416 |
11-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17-one |
525916 |
4-hydroxy-5-methyl-2-propan-2-yl-cyclohexan-1-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|