| Compound Information | SONAR Target prediction | | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | | Unique Identifier: | SPE00300110 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 200.149 g/mol | | X log p: | -1.167 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | | Class: | sesquiterpene | | Source: | derivative Panax ginseng | | Reference: | Chem Pharm Bull 35: 1975 (1987) |
| Species: |
4932 |
| Condition: |
RAD52 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.5797±0.0182434 |
| Normalized OD Score: sc h |
1.0066±0.0148698 |
| Z-Score: |
0.2749±0.623266 |
| p-Value: |
0.671268 |
| Z-Factor: |
-33.0935 |
| Fitness Defect: |
0.3986 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.90 Celcius | | Date: | 2007-10-26 YYYY-MM-DD | | Plate CH Control (+): | 0.04115±0.00048 | | Plate DMSO Control (-): | 0.5557749999999999±0.02951 | | Plate Z-Factor: | 0.8135 |
| png ps pdf |
| 247934 |
(5R,8S,9S,10S,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cycl openta[a]phenanthren-11-one |
| 281941 |
6-(hydroxymethyl)norbornan-2-one |
| 301398 |
3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclop enta[a]phenanthren-6-one |
| 351782 |
17-acetyl-16-(hydroxymethyl)-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a ]phenanthren-3-one |
| 380802 |
(8aS)-5-hydroxydecalin-1-one |
| 382537 |
n/a |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|