| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | CIN8 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7987±0.00438406 |  
		| Normalized OD Score: sc h | 0.9976±0.00483822 |  
		| Z-Score: | 0.5657±0.255746 |  
		| p-Value: | 0.577868 |  
		| Z-Factor: | -4.79071 |  
		| Fitness Defect: | 0.5484 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.20 Celcius |  | Date: | 2006-02-24 YYYY-MM-DD |  | Plate CH Control (+): | 0.039599999999999996±0.00134 |  | Plate DMSO Control (-): | 0.766075±0.01262 |  | Plate Z-Factor: | 0.9382 | 
 |  png ps
 pdf
 | 
 
 
	
		| 227666 | (5S,8S,9S,10S,13S,14S,17S)-17-hydroxy-10,13,17-trimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopen ta[a]phenanthrene-3,11-dione
 |  
		| 227669 | (5R,8S,9S,10S,11S,13S,14S)-11-hydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocycl openta[a]phenanthren-17-one
 |  
		| 229699 | 7-hydroxy-7-methyl-decan-4-one |  
		| 244945 | 3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahydrocyclopenta[a]phenanthren-17 -one
 |  
		| 246161 | (5R,8R,9S,10S,12S,13R,14S,17S)-17-acetyl-12-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tet radecahydrocyclopenta[a]phenanthren-3-one
 |  
		| 246205 | 1-[(3R,5R,8R,9S,10S,12S,13R,14S,17S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tet radecahydro-1H-cyclopenta[a]phenanthren-17-yl]ethanone
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |