Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
SKT5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6769±0.00657609 |
Normalized OD Score: sc h |
0.9900±0.00730731 |
Z-Score: |
-0.5003±0.366332 |
p-Value: |
0.628534 |
Z-Factor: |
-6.70248 |
Fitness Defect: |
0.4644 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-06-17 YYYY-MM-DD | Plate CH Control (+): | 0.040525000000000005±0.00041 | Plate DMSO Control (-): | 0.6823999999999999±0.01173 | Plate Z-Factor: | 0.9330 |
| png ps pdf |
15955975 |
(3S,10R,13R,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11,12,14,15,16,1 7-tetradecahydrocyclopenta[a]phenanthren-6-one |
15971453 |
n/a |
16061347 |
(3S,5S,8S,9S,10R,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-3-hydroxy-10,13-dimethyl-1,2,3,4,5,7, 8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
16061357 |
(3S,5S,8R,9R,10S,11S,13S,14S)-3,11-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,14,15,16-tetradecahy drocyclopenta[a]phenanthren-17-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|