| Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		PPZ1 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8366±0.00735391 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0199±0.00988181 | 
	 
	
		| Z-Score: | 
		1.0158±0.53144 | 
	 
	
		| p-Value: | 
		0.343112 | 
	 
	
		| Z-Factor: | 
		-3.34883 | 
	 
	
		| Fitness Defect: | 
		1.0697 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 23.50 Celcius |  | Date: | 2006-05-17 YYYY-MM-DD |  | Plate CH Control (+): | 0.039099999999999996±0.00336 |  | Plate DMSO Control (-): | 0.803775±0.01988 |  | Plate Z-Factor: | 0.9204 |  
  |  png ps pdf |  
 
 
	
		| 8182948 | 
		(3S,5S,8R,9R,10S,13R,14S,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one | 
	 
	
		| 9437144 | 
		(3S,5R,8S,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one | 
	 
	
		| 9437145 | 
		(3S,5R,8S,9R,10S,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one | 
	 
	
		| 9437146 | 
		(3R,5R,8S,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one | 
	 
	
		| 9437147 | 
		(3R,5R,8S,9R,10S,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one | 
	 
	
		| 11943875 | 
		(3S,5S,8S,9S,10R,13R,14R,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |