Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
WHI5 |
Replicates: |
2 |
Raw OD Value: r im |
0.6448±0.0304763 |
Normalized OD Score: sc h |
0.9789±0.0078844 |
Z-Score: |
-0.6347±0.222358 |
p-Value: |
0.530712 |
Z-Factor: |
-10.6887 |
Fitness Defect: |
0.6335 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2008-09-16 YYYY-MM-DD | Plate CH Control (+): | 0.04105±0.00058 | Plate DMSO Control (-): | 0.670625±0.02966 | Plate Z-Factor: | 0.8333 |
| png ps pdf |
8182948 |
(3S,5S,8R,9R,10S,13R,14S,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one |
9437144 |
(3S,5R,8S,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one |
9437145 |
(3S,5R,8S,9R,10S,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one |
9437146 |
(3R,5R,8S,9R,10R,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one |
9437147 |
(3R,5R,8S,9R,10S,13R,14S,17R)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one |
11943875 |
(3S,5S,8S,9S,10R,13R,14R,17S)-3,17-dihydroxy-10,13-dimethyl-1,2,3,4,5,6,7,8,9,12,14,15,16,17-tetradecahy drocyclopenta[a]phenanthren-11-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|