| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | CLA4 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6949±0.00120208 |  
		| Normalized OD Score: sc h | 1.0119±0.000757928 |  
		| Z-Score: | 0.5270±0.053872 |  
		| p-Value: | 0.59845 |  
		| Z-Factor: | -6.62555 |  
		| Fitness Defect: | 0.5134 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.60 Celcius |  | Date: | 2007-09-12 YYYY-MM-DD |  | Plate CH Control (+): | 0.04025±0.00093 |  | Plate DMSO Control (-): | 0.67225±0.02596 |  | Plate Z-Factor: | 0.8920 | 
 |  png ps
 pdf
 | 
 
 
	
		| 7121443 | (3S,5S,8S,9R,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one
 |  
		| 7790517 | (3S,5S,8R,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one
 |  
		| 8029386 | (3S,5S,8R,9S,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one
 |  
		| 8182901 | (3S,5S,8R,9R,10S,13R,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one
 |  
		| 8182917 | (3S,5S,8R,9R,10S,13R,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one
 |  
		| 8182933 | (3S,5S,8R,9R,10S,13R,14S,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |