Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
BY4741 |
Replicates: |
2 |
Raw OD Value: r im |
0.7674±0.0523966 |
Normalized OD Score: sc h |
0.9880±0.00920007 |
Z-Score: |
0.4927±0.405629 |
p-Value: |
0.636266 |
Z-Factor: |
-5.51506 |
Fitness Defect: |
0.4521 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|B8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 28.10 Celcius | Date: | 2005-12-15 YYYY-MM-DD | Plate CH Control (+): | 0.03842500000000001±0.00176 | Plate DMSO Control (-): | 0.756625±0.01629 | Plate Z-Factor: | 0.9116 |
| png ps pdf |
7099989 |
(3S,5S,8S,9R,10S,13R,14R,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
7099990 |
(3S,5S,8S,9S,10S,13R,14S,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
7099991 |
(3S,5S,8S,9S,10S,13R,14R,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
7121440 |
(3S,5S,8S,9R,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
7121441 |
(3S,5S,8S,9R,10R,13R,14S,17S)-3-hydroxy-10,13-dimethyl-17-[(2S)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
7121442 |
(3S,5S,8S,9R,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-17-[(2R)-6-methylheptan-2-yl]-1,2,3,4,5,7,8,9,11, 12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|