Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
FAA2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6866±0.00219203 |
Normalized OD Score: sc h |
0.9893±0.00334894 |
Z-Score: |
-0.5991±0.225055 |
p-Value: |
0.554156 |
Z-Factor: |
-4.1314 |
Fitness Defect: |
0.5903 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.40 Celcius | Date: | 2008-05-27 YYYY-MM-DD | Plate CH Control (+): | 0.0402±0.00073 | Plate DMSO Control (-): | 0.6814499999999999±0.00982 | Plate Z-Factor: | 0.9520 |
| png ps pdf |
7095739 |
(2R,4R,5S)-4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |
7099790 |
(3S,5R,8R,9R,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopent a[a]phenanthrene-6,17-dione |
7099791 |
(3S,5S,8R,9R,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopent a[a]phenanthrene-6,17-dione |
7099792 |
(3S,5R,8S,9R,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopent a[a]phenanthrene-6,17-dione |
7099793 |
(3S,5S,8S,9R,10R,13S,14S)-3-hydroxy-10,13-dimethyl-2,3,4,5,7,8,9,11,12,14,15,16-dodecahydro-1H-cyclopent a[a]phenanthrene-6,17-dione |
7099988 |
(3S,5S,8S,9R,10S,13R,14S,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|