| Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RAD52 | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.5797±0.0182434 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0066±0.0148698 | 
	 
	
		| Z-Score: | 
		0.2749±0.623266 | 
	 
	
		| p-Value: | 
		0.671268 | 
	 
	
		| Z-Factor: | 
		-33.0935 | 
	 
	
		| Fitness Defect: | 
		0.3986 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 22.90 Celcius |  | Date: | 2007-10-26 YYYY-MM-DD |  | Plate CH Control (+): | 0.04115±0.00048 |  | Plate DMSO Control (-): | 0.5557749999999999±0.02951 |  | Plate Z-Factor: | 0.8135 |  
  |  png ps pdf |  
 
 
	
		| 6566106 | 
		(3S,5R,8R,9S,10S,13S,14R,17S)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one | 
	 
	
		| 6595834 | 
		n/a | 
	 
	
		| 6708589 | 
		1-[(3R,12S)-3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta [a]phenanthren-17-yl]ethanone | 
	 
	
		| 6710665 | 
		(3S,5S,10R,13R)-3-hydroxy-10,13-dimethyl-17-(6-methylheptan-2-yl)-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetr adecahydrocyclopenta[a]phenanthren-6-one | 
	 
	
		| 6918983 | 
		(1S,3S)-5-hydroxyadamantan-2-one | 
	 
	
		| 6932888 | 
		(1R,3R)-5-hydroxyadamantan-2-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |