Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
VPS35 |
Replicates: |
2 |
Raw OD Value: r im |
0.6861±0.0019799 |
Normalized OD Score: sc h |
0.9688±0.00432094 |
Z-Score: |
-1.5683±0.246548 |
p-Value: |
0.122371 |
Z-Factor: |
-1.39299 |
Fitness Defect: |
2.1007 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 29.80 Celcius | Date: | 2008-02-20 YYYY-MM-DD | Plate CH Control (+): | 0.041475±0.00232 | Plate DMSO Control (-): | 0.6861±0.01261 | Plate Z-Factor: | 0.9460 |
| png ps pdf |
6453554 |
(5R,6R,8S,9S,10R,13R,14S,17S)-17-acetyl-6-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydrocyclopenta[a]phenanthren-3-one |
6543607 |
1-[(1R,2S,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]propan-2-one |
6543697 |
(4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-decalin-2-one |
6543735 |
(3R,5S,8S,9R,10S,13S,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
6552875 |
(3R,5S,8R,9R,10R,13S,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one |
6565929 |
(2R,4S,5S)-4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|