| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | REF2 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.4095±0.0630739 |  
		| Normalized OD Score: sc h | 0.9569±0.00107397 |  
		| Z-Score: | -1.2537±0.0405886 |  
		| p-Value: | 0.210142 |  
		| Z-Factor: | -1.46497 |  
		| Fitness Defect: | 1.56 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 9|G7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 26.50 Celcius |  | Date: | 2008-08-27 YYYY-MM-DD |  | Plate CH Control (+): | 0.04185±0.00075 |  | Plate DMSO Control (-): | 0.40549999999999997±0.01414 |  | Plate Z-Factor: | 0.8563 | 
 |  png ps
 pdf
 | 
 
 
	
		| 6453554 | (5R,6R,8S,9S,10R,13R,14S,17S)-17-acetyl-6-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetra decahydrocyclopenta[a]phenanthren-3-one
 |  
		| 6543607 | 1-[(1R,2S,4aS,8aR)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]propan-2-one |  
		| 6543697 | (4aR,8S,8aS)-8-hydroxy-4a,8-dimethyl-decalin-2-one |  
		| 6543735 | (3R,5S,8S,9R,10S,13S,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,1 6,17-tetradecahydrocyclopenta[a]phenanthren-6-one
 |  
		| 6552875 | (3R,5S,8R,9R,10R,13S,14S,17R)-3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,14,15,16 ,17-tetradecahydrocyclopenta[a]phenanthren-12-one
 |  
		| 6565929 | (2R,4S,5S)-4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |