| Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110  |  | MolClass: |  Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) |  
 
 
	
		| Species: | 
		4932 | 
	 
	
		| Condition: | 
		RPL9B | 
	 
	
		| Replicates: | 
		2 | 
	 
	
		| Raw OD Value: r im | 
		0.8446±0.000494975 | 
	 
	
		| Normalized OD Score: sc h | 
		1.0323±0.0154537 | 
	 
	
		| Z-Score: | 
		0.9519±0.414232 | 
	 
	
		| p-Value: | 
		0.361576 | 
	 
	
		| Z-Factor: | 
		-1.65962 | 
	 
	
		| Fitness Defect: | 
		1.0173 | 
	 
	
		| Bioactivity Statement: | 
		Nonactive | 
	 
 
| Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.10 Celcius |  | Date: | 2006-03-10 YYYY-MM-DD |  | Plate CH Control (+): | 0.038325±0.00097 |  | Plate DMSO Control (-): | 0.8152250000000001±0.01476 |  | Plate Z-Factor: | 0.9125 |  
  |  png ps pdf |  
 
 
	
		| 5377867 | 
		7-hydroxy-6,7-dihydro-5H-inden-4-one | 
	 
	
		| 5743076 | 
		n/a | 
	 
	
		| 5743080 | 
		n/a | 
	 
	
		| 6428795 | 
		n/a | 
	 
	
		| 6429556 | 
		(3R,5S,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one | 
	 
	
		| 6429557 | 
		(3R,5R,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one | 
	 
 
 | internal high similarity DBLink  | Rows returned: 3 |  |   
 |  active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  |  
  
 |