| Compound Information | SONAR Target prediction | | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | | Unique Identifier: | SPE00300110 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 200.149 g/mol | | X log p: | -1.167 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | | Class: | sesquiterpene | | Source: | derivative Panax ginseng | | Reference: | Chem Pharm Bull 35: 1975 (1987) |
| Species: |
4932 |
| Condition: |
DCG1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7165±0.022981 |
| Normalized OD Score: sc h |
1.0179±0.0312813 |
| Z-Score: |
0.9754±1.7109 |
| p-Value: |
0.421774 |
| Z-Factor: |
-6.36449 |
| Fitness Defect: |
0.8633 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 22.40 Celcius | | Date: | 2007-10-25 YYYY-MM-DD | | Plate CH Control (+): | 0.03975±0.00056 | | Plate DMSO Control (-): | 0.696025±0.02023 | | Plate Z-Factor: | 0.9010 |
| png ps pdf |
| 5377867 |
7-hydroxy-6,7-dihydro-5H-inden-4-one |
| 5743076 |
n/a |
| 5743080 |
n/a |
| 6428795 |
n/a |
| 6429556 |
(3R,5S,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one |
| 6429557 |
(3R,5R,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|