Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
SSE1 |
Replicates: |
2 |
Raw OD Value: r im |
0.4162±0.0252437 |
Normalized OD Score: sc h |
0.9699±0.0222919 |
Z-Score: |
-0.7992±0.54514 |
p-Value: |
0.457594 |
Z-Factor: |
-3.75032 |
Fitness Defect: |
0.7818 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 23.60 Celcius | Date: | 2008-05-01 YYYY-MM-DD | Plate CH Control (+): | 0.041125±0.00127 | Plate DMSO Control (-): | 0.41065±0.02097 | Plate Z-Factor: | 0.8202 |
| png ps pdf |
5377867 |
7-hydroxy-6,7-dihydro-5H-inden-4-one |
5743076 |
n/a |
5743080 |
n/a |
6428795 |
n/a |
6429556 |
(3R,5S,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one |
6429557 |
(3R,5R,11S)-3,11-dihydroxy-1,2,3,4,5,6,7,8,9,10,11,12,13,14,15,16-hexadecahydrocyclopenta[a]phenanthren- 17-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|