| Compound Information | SONAR Target prediction | | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | | Unique Identifier: | SPE00300110 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 200.149 g/mol | | X log p: | -1.167 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 17.07 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 2 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | | Class: | sesquiterpene | | Source: | derivative Panax ginseng | | Reference: | Chem Pharm Bull 35: 1975 (1987) |
| Species: |
4932 |
| Condition: |
ROM2 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.6611±0.00381838 |
| Normalized OD Score: sc h |
0.9952±0.017973 |
| Z-Score: |
-0.2237±0.799601 |
| p-Value: |
0.581316 |
| Z-Factor: |
-25.504 |
| Fitness Defect: |
0.5425 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|B8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 23.50 Celcius | | Date: | 2007-11-21 YYYY-MM-DD | | Plate CH Control (+): | 0.04095±0.00040 | | Plate DMSO Control (-): | 0.6394249999999999±0.03778 | | Plate Z-Factor: | 0.8005 |
| png ps pdf |
| 4458722 |
4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |
| 4576916 |
6,12-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3 -one |
| 4579738 |
n/a |
| 4665959 |
17-hydroxy-10,13,17-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |
| 5068919 |
3,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6 -one |
| 5340971 |
1-[(2R,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]propan-2-one |
| internal high similarity DBLink | Rows returned: 3 | |
| active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|