| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | MDH1 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.7649±0.0330926 |  
		| Normalized OD Score: sc h | 1.0051±0.0070931 |  
		| Z-Score: | 0.2677±0.373807 |  
		| p-Value: | 0.796004 |  
		| Z-Factor: | -27.1171 |  
		| Fitness Defect: | 0.2282 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | Spectrum |  | Plate Number and Position: | 3|B8 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.00 Celcius |  | Date: | 2007-08-07 YYYY-MM-DD |  | Plate CH Control (+): | 0.040150000000000005±0.00041 |  | Plate DMSO Control (-): | 0.746675±0.02229 |  | Plate Z-Factor: | 0.9287 | 
 |  png ps
 pdf
 | 
 
 
	
		| 4458722 | 4-hydroxy-2,5-ditert-butyl-cyclohexan-1-one |  
		| 4576916 | 6,12-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3 -one
 |  
		| 4579738 | n/a |  
		| 4665959 | 17-hydroxy-10,13,17-trimethyl-2,3,4,5,6,7,8,9,12,14,15,16-dodecahydro-1H-cyclopenta[a]phenanthren-11-one |  
		| 5068919 | 3,16-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6 -one
 |  
		| 5340971 | 1-[(2R,8aS)-2-hydroxy-2,5,5,8a-tetramethyl-decalin-1-yl]propan-2-one |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |