| 
 | Compound Information | SONAR Target prediction |  | Name: | 3-NOR-3-OXOPANASINSAN-6-OL |  | Unique Identifier: | SPE00300110 |  | MolClass: | Checkout models in ver1.5 and ver1.0 |  | Molecular Formula: |  |  | Molecular Weight: | 200.149 g/mol |  | X log p: | -1.167  (online calculus) |  | Lipinksi Failures | 0 |  | TPSA | 17.07 |  | Hydrogen Bond Donor Count: | 0 |  | Hydrogen Bond Acceptors Count: | 2 |  | Rotatable Bond Count: | 0 |  | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O |  | Class: | sesquiterpene |  | Source: | derivative Panax ginseng |  | Reference: | Chem Pharm Bull 35: 1975 (1987) | 
 
 
	
		| Species: | 4932 |  
		| Condition: | QCR8 |  
		| Replicates: | 2 |  
		| Raw OD Value: r im | 0.6918±0.00714178 |  
		| Normalized OD Score: sc h | 1.0121±0.00348313 |  
		| Z-Score: | 0.4982±0.14313 |  
		| p-Value: | 0.620122 |  
		| Z-Factor: | -15.4434 |  
		| Fitness Defect: | 0.4778 |  
		| Bioactivity Statement: | Nonactive |  | | Experimental Conditions |  |  | Library: | SPECMTS3 |  | Plate Number and Position: | 9|G7 |  | Drug Concentration: | 50.00 nM |  | OD Absorbance: | 600 nm |  | Robot Temperature: | 25.80 Celcius |  | Date: | 2008-04-25 YYYY-MM-DD |  | Plate CH Control (+): | 0.039400000000000004±0.00033 |  | Plate DMSO Control (-): | 0.65645±0.02374 |  | Plate Z-Factor: | 0.8551 | 
 |  png ps
 pdf
 | 
 
 
	
		| 4246410 | 6,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3 -one
 |  
		| 4303575 | 17-hydroxy-10,13,17-trimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dion e
 |  
		| 4307344 | 3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[ a]phenanthren-6-one
 |  
		| 4309017 | 1-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenan thren-17-yl)ethanone
 |  
		| 4357793 | 17-acetyl-6-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanth ren-3-one
 |  
		| 4384610 | 17-acetyl-12-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-3-one
 |  
 | internal high similarity DBLink  | Rows returned: 3 |  | 
 
 | active | Cluster 883 | Additional Members: 1 | Rows returned: 0 |  | 
 
 |