Compound Information | SONAR Target prediction | Name: | 3-NOR-3-OXOPANASINSAN-6-OL | Unique Identifier: | SPE00300110 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 200.149 g/mol | X log p: | -1.167 (online calculus) | Lipinksi Failures | 0 | TPSA | 17.07 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 2 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC23C1CCC2(C)C(O)CCC3=O | Class: | sesquiterpene | Source: | derivative Panax ginseng | Reference: | Chem Pharm Bull 35: 1975 (1987) |
Species: |
4932 |
Condition: |
CHS7 |
Replicates: |
2 |
Raw OD Value: r im |
0.5536±0.0137886 |
Normalized OD Score: sc h |
0.9603±0.0198687 |
Z-Score: |
-1.3027±0.742302 |
p-Value: |
0.252134 |
Z-Factor: |
-1.97465 |
Fitness Defect: |
1.3778 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 9|G7 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.80 Celcius | Date: | 2008-02-21 YYYY-MM-DD | Plate CH Control (+): | 0.040325±0.00089 | Plate DMSO Control (-): | 0.5615749999999999±0.01027 | Plate Z-Factor: | 0.9362 |
| png ps pdf |
4246410 |
6,16-dihydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-3 -one |
4303575 |
17-hydroxy-10,13,17-trimethyl-1,2,4,5,6,7,8,9,12,14,15,16-dodecahydrocyclopenta[a]phenanthrene-3,11-dion e |
4307344 |
3-hydroxy-17-(1-hydroxyethyl)-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[ a]phenanthren-6-one |
4309017 |
1-(3,12-dihydroxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenan thren-17-yl)ethanone |
4357793 |
17-acetyl-6-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanth ren-3-one |
4384610 |
17-acetyl-12-hydroxy-10,13-dimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenant hren-3-one |
internal high similarity DBLink | Rows returned: 3 | |
active | Cluster 883 | Additional Members: 1 | Rows returned: 0 | |
|