Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
PFK2 |
Replicates: |
2 |
Raw OD Value: r im |
0.3834±0.0113844 |
Normalized OD Score: sc h |
0.8608±0.0189147 |
Z-Score: |
-4.4680±0.560656 |
p-Value: |
0.0000239194 |
Z-Factor: |
-0.176341 |
Fitness Defect: |
10.6408 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.20 Celcius | Date: | 2008-05-10 YYYY-MM-DD | Plate CH Control (+): | 0.040525000000000005±0.00725 | Plate DMSO Control (-): | 0.457075±0.01601 | Plate Z-Factor: | 0.8824 |
| png ps pdf |
957 |
octan-1-ol |
1107 |
2,3,4,5,6,7,8,9,10,11,12,13,14,15,16,17-hexadecahydro-1H-cyclopenta[a]phenanthren-3-ol |
1213 |
4,8a-dimethyldecalin-4a-ol |
1254 |
5-methyl-2-propan-2-yl-cyclohexan-1-ol |
2682 |
hexadecan-1-ol |
3240 |
10,13-dimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a ]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
nonactive | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|