Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
LAT1 |
Replicates: |
2 |
Raw OD Value: r im |
0.5719±0.0195869 |
Normalized OD Score: sc h |
0.8589±0.0191497 |
Z-Score: |
-6.9208±0.499222 |
p-Value: |
0.0000000000257106 |
Z-Factor: |
0.240795 |
Fitness Defect: |
24.3841 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 27.40 Celcius | Date: | 2008-04-23 YYYY-MM-DD | Plate CH Control (+): | 0.040374999999999994±0.00045 | Plate DMSO Control (-): | 0.660625±0.01078 | Plate Z-Factor: | 0.9479 |
| png ps pdf |
150781 |
octadecan-2-ol |
155021 |
(8R,9R,10S,13S,14S,17S)-17-ethyl-13-methyl-2,3,4,5,6,7,8,9,10,11,12,14,15,16-tetradecahydro-1H-cyclopent a[a]phenanthren-17-ol |
155147 |
3,6-dimethyloctan-1-ol |
156150 |
tritriacontan-1-ol |
157581 |
(1S,5R)-7,7-dimethylnorpinan-6-ol |
159064 |
(3R,7R)-3,7,11-trimethyldodecan-1-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|