Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
BEM2 |
Replicates: |
2 |
Raw OD Value: r im |
0.6365±0.0159099 |
Normalized OD Score: sc h |
0.7950±0.023679 |
Z-Score: |
-6.0224±0.600577 |
p-Value: |
0.0000000109141 |
Z-Factor: |
-0.0927927 |
Fitness Defect: |
18.3332 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|B6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.20 Celcius | Date: | 2006-03-25 YYYY-MM-DD | Plate CH Control (+): | 0.040749999999999995±0.00146 | Plate DMSO Control (-): | 0.6167±0.01341 | Plate Z-Factor: | 0.9250 |
| png ps pdf |
12121995 |
(1S,3aS,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1H-inden-1-ol |
13109021 |
(2S,4S)-2,4,6-trimethylheptan-1-ol |
14512388 |
barium(+2) cation; 2-ethylhexan-1-olate |
15559396 |
(3S,8S,9S,10S,13R,14S,17R)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,1 2,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
15605903 |
(1S,2S,4R)-4-methyl-2-propan-2-yl-cyclohexan-1-ol |
15939348 |
[(1S,5S,7R)-7-bicyclo[3.2.0]heptyl]methanol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|