Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
APC9 |
Replicates: |
2 |
Raw OD Value: r im |
0.7136±0.00714178 |
Normalized OD Score: sc h |
1.0113±0.00193194 |
Z-Score: |
0.6163±0.114248 |
p-Value: |
0.53899 |
Z-Factor: |
-6.66936 |
Fitness Defect: |
0.6181 |
Bioactivity Statement: |
Nonactive |
Experimental Conditions | | Library: | Spectrum | Plate Number and Position: | 3|B6 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 21.50 Celcius | Date: | 2007-11-22 YYYY-MM-DD | Plate CH Control (+): | 0.04165±0.00070 | Plate DMSO Control (-): | 0.691225±0.02158 | Plate Z-Factor: | 0.8986 |
| png ps pdf |
7352906 |
n/a |
7352936 |
(1R,2R,5S)-5-methyl-2-propyl-cyclohexan-1-ol |
7352937 |
(1R,2S,5S)-5-methyl-2-propyl-cyclohexan-1-ol |
7352938 |
(1R,2R,5R)-5-methyl-2-propyl-cyclohexan-1-ol |
7359279 |
(3S,5S,8R,9R,10S,13R,14S,17S)-17-[(2R,5S)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,1 1,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
7359280 |
(3S,5S,8R,9R,10S,13R,14S,17S)-17-[(2R,5R)-5-ethyl-6-methyl-heptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,1 1,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|