Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
RGP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3450±0.0236174 |
Normalized OD Score: sc h |
0.7999±0.0521355 |
Z-Score: |
-5.2166±1.29016 |
p-Value: |
0.00000837432 |
Z-Factor: |
-0.278928 |
Fitness Defect: |
11.6903 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2008-06-26 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00204 | Plate DMSO Control (-): | 0.4414±0.01397 | Plate Z-Factor: | 0.8920 |
| png ps pdf |
3085915 |
(1S,2S,6R)-2-cyclopentyl-6-methyl-cyclohexan-1-ol |
3094314 |
1-cyclododecylpropan-2-ol |
3107830 |
4-(4-propylcyclohexyl)cyclohexan-1-ol |
3126233 |
4-(4-pentylcyclohexyl)cyclohexan-1-ol |
3271423 |
5-methyl-2-propyl-cyclohexan-1-ol |
3278367 |
17-(5,6-dimethylheptan-2-yl)-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopen ta[a]phenanthrene-3,11-diol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|