Compound Information | SONAR Target prediction | Name: | beta-CARYOPHYLLENE ALCOHOL | Unique Identifier: | SPE00300105 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | -0.484 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 0 | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | Class: | sesquiterpene | Source: | palmarosa oil, Cymbopogon martini | Reference: | Aust J Chem 41: 1755 (1988) | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | Drug_type: | Experimental | Drugbank_id: | EXPT00530 | Logp: | 3.73 | Drug_category: | Sex Hormone-Binding Globulin inhibitor | Organisms_affected: | -1 |
Species: |
4932 |
Condition: |
VPH1 |
Replicates: |
2 |
Raw OD Value: r im |
0.2924±0.0130108 |
Normalized OD Score: sc h |
0.7089±0.0161831 |
Z-Score: |
-5.2476±0.0221247 |
p-Value: |
0.000000154594 |
Z-Factor: |
0.365166 |
Fitness Defect: |
15.6825 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|D8 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 24.70 Celcius | Date: | 2008-03-01 YYYY-MM-DD | Plate CH Control (+): | 0.04005±0.00037 | Plate DMSO Control (-): | 0.389475±0.01700 | Plate Z-Factor: | 0.8357 |
| png ps pdf |
37147 |
2,2,9,9-tetramethyldecane-1,10-diol |
37153 |
decane-1,10-diol |
38627 |
hentetracontan-1-ol |
39421 |
6,10,13-trimethyl-17-(6-methylheptan-2-yl)-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopent a[a]phenanthren-3-ol |
41076 |
4-pentylcyclohexan-1-ol |
41143 |
5-methylheptan-2-ol |
internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|