| Compound Information | SONAR Target prediction | | Name: | beta-CARYOPHYLLENE ALCOHOL | | Unique Identifier: | SPE00300105 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.16 g/mol | | X log p: | -0.484 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 0 | | Canonical Smiles: | CC1(C)CC2C1CCC1(C)CCCC2(O)C1 | | Class: | sesquiterpene | | Source: | palmarosa oil, Cymbopogon martini | | Reference: | Aust J Chem 41: 1755 (1988) | | Generic_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Chemical_iupac_name: | 5-ALPHA-ANDROSTANE-3-BETA,17BETA-DIOL | | Drug_type: | Experimental | | Drugbank_id: | EXPT00530 | | Logp: | 3.73 | | Drug_category: | Sex Hormone-Binding Globulin inhibitor | | Organisms_affected: | -1 |
| Species: |
4932 |
| Condition: |
VPH1 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2924±0.0130108 |
| Normalized OD Score: sc h |
0.7089±0.0161831 |
| Z-Score: |
-5.2476±0.0221247 |
| p-Value: |
0.000000154594 |
| Z-Factor: |
0.365166 |
| Fitness Defect: |
15.6825 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 13|D8 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 24.70 Celcius | | Date: | 2008-03-01 YYYY-MM-DD | | Plate CH Control (+): | 0.04005±0.00037 | | Plate DMSO Control (-): | 0.389475±0.01700 | | Plate Z-Factor: | 0.8357 |
| png ps pdf |
| 276345 |
n/a |
| 277085 |
bicyclo[3.3.1]nonan-7-ol |
| 277451 |
2-(4a-methyldecalin-2-yl)ethanol |
| 278223 |
4a-methyldecalin-2-ol |
| 278561 |
2,3-diethyloctan-1-ol |
| 280762 |
3,10,13-trimethyl-1,2,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,16-diol |
| internal high similarity DBLink | Rows returned: 38 | 1 2 3 4 5 6 7 Next >> |
| active | Cluster 8273 | Additional Members: 1 | Rows returned: 0 | |
|