| Compound Information | SONAR Target prediction | | Name: | CADIN-4-EN-10-OL | | Unique Identifier: | SPE00300055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.16 g/mol | | X log p: | 2.173 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)C1CCC(C)(O)C2CCC(C)=CC12 | | Class: | sesquiterpene | | Source: | Chamaecyparis spp and Juniperus spp. | | Reference: | Tet Lett 1968: 1913 |
| Species: |
4932 |
| Condition: |
APC9 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.7003±0.00127279 |
| Normalized OD Score: sc h |
0.9890±0.00708622 |
| Z-Score: |
-0.5979±0.393982 |
| p-Value: |
0.565112 |
| Z-Factor: |
-11.3495 |
| Fitness Defect: |
0.5707 |
| Bioactivity Statement: |
Nonactive |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 21.50 Celcius | | Date: | 2007-11-22 YYYY-MM-DD | | Plate CH Control (+): | 0.04165±0.00070 | | Plate DMSO Control (-): | 0.691225±0.02158 | | Plate Z-Factor: | 0.8986 |
|  png
ps
pdf |
| 6432503 |
6-methyl-2-[(1R)-4-methyl-1-cyclohex-3-enyl]hept-5-en-2-ol |
| 6440718 |
(3S,5S,8R,9S,10S,12R,13R,14R,17S)-17-[(Z)-7-hydroxy-6-methyl-hept-2-en-2-yl]-4,4,8,10,14-pentamethyl-2,3
,5,6,7,9,11,12,13,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,12-diol |
| 6506009 |
(2R)-6-methyl-2-(4-methyl-1-cyclohex-3-enyl)hept-5-en-2-ol |
| 6561182 |
(3R,4aS,6aS,6aS,8aR,12aS,14aR,14bR)-8a-(hydroxymethyl)-4,4,6a,6a,11,11,14b-heptamethyl-1,2,3,4a,5,6,8,9,
10,12,12a,13,14,14a-tetradecahydropicen-3-ol |
| 6579449 |
[(1R,4R,6S)-6-bicyclo[2.2.1]hept-2-enyl]methanol |
| 6617446 |
1-(6-methyl-6-bicyclo[2.2.1]hept-2-enyl)ethanol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 783 | Additional Members: 1 | Rows returned: 0 | |
|
