Compound Information | SONAR Target prediction | Name: | CADIN-4-EN-10-OL | Unique Identifier: | SPE00300055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | 2.173 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)C1CCC(C)(O)C2CCC(C)=CC12 | Class: | sesquiterpene | Source: | Chamaecyparis spp and Juniperus spp. | Reference: | Tet Lett 1968: 1913 |
Species: |
4932 |
Condition: |
YPT6 |
Replicates: |
2 |
Raw OD Value: r im |
0.4183±0.00742462 |
Normalized OD Score: sc h |
0.8103±0.00125616 |
Z-Score: |
-5.3092±0.0426188 |
p-Value: |
0.000000111587 |
Z-Factor: |
0.487134 |
Fitness Defect: |
16.0085 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 25.60 Celcius | Date: | 2008-06-05 YYYY-MM-DD | Plate CH Control (+): | 0.0407±0.00049 | Plate DMSO Control (-): | 0.512175±0.01640 | Plate Z-Factor: | 0.8807 |
| png ps pdf |
6429182 |
n/a |
6429185 |
(1R,4R)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
6431162 |
(3S,5S)-10,13-dimethyl-2,3,4,5,6,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
6431163 |
(3S,5S)-10,13-dimethyl-2,3,4,5,6,7,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
6431302 |
(1S,4R)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
6432221 |
(1S,4S)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 783 | Additional Members: 1 | Rows returned: 0 | |
|