| Compound Information | SONAR Target prediction | | Name: | CADIN-4-EN-10-OL | | Unique Identifier: | SPE00300055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.16 g/mol | | X log p: | 2.173 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)C1CCC(C)(O)C2CCC(C)=CC12 | | Class: | sesquiterpene | | Source: | Chamaecyparis spp and Juniperus spp. | | Reference: | Tet Lett 1968: 1913 |
| Species: |
4932 |
| Condition: |
SPT3 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.2683±0.0360624 |
| Normalized OD Score: sc h |
0.5900±0.0654809 |
| Z-Score: |
-6.5403±0.852445 |
| p-Value: |
0.00000000144694 |
| Z-Factor: |
0.27721 |
| Fitness Defect: |
20.3538 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | SPECMTS3 | | Plate Number and Position: | 13|C10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2008-02-13 YYYY-MM-DD | | Plate CH Control (+): | 0.040825±0.00133 | | Plate DMSO Control (-): | 0.4344±0.01306 | | Plate Z-Factor: | 0.8802 |
|  png
ps
pdf |
| 5743899 |
7,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,5,8-hexahydro-1H-naphthalen-1-ol |
| 5744139 |
(8,8-dimethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl)methanol |
| 6097621 |
(2S)-6-methyl-2-(4-methyl-1-cyclohex-3-enyl)hept-5-en-2-ol |
| 6424423 |
n/a |
| 6428325 |
(4S)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
| 6428423 |
(1R,4S)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 783 | Additional Members: 1 | Rows returned: 0 | |
|
