Compound Information | SONAR Target prediction | Name: | CADIN-4-EN-10-OL | Unique Identifier: | SPE00300055 | MolClass: | Checkout models in ver1.5 and ver1.0 | Molecular Formula: | | Molecular Weight: | 196.16 g/mol | X log p: | 2.173 (online calculus) | Lipinksi Failures | 0 | TPSA | 0 | Hydrogen Bond Donor Count: | 0 | Hydrogen Bond Acceptors Count: | 1 | Rotatable Bond Count: | 1 | Canonical Smiles: | CC(C)C1CCC(C)(O)C2CCC(C)=CC12 | Class: | sesquiterpene | Source: | Chamaecyparis spp and Juniperus spp. | Reference: | Tet Lett 1968: 1913 |
Species: |
4932 |
Condition: |
RGP1 |
Replicates: |
2 |
Raw OD Value: r im |
0.3423±0.0046669 |
Normalized OD Score: sc h |
0.7710±0.00531676 |
Z-Score: |
-5.9771±0.0579517 |
p-Value: |
0.00000000234098 |
Z-Factor: |
0.507966 |
Fitness Defect: |
19.8727 |
Bioactivity Statement: |
Active |
Experimental Conditions | | Library: | SPECMTS3 | Plate Number and Position: | 13|C10 | Drug Concentration: | 50.00 nM | OD Absorbance: | 600 nm | Robot Temperature: | 26.30 Celcius | Date: | 2008-06-26 YYYY-MM-DD | Plate CH Control (+): | 0.03995±0.00204 | Plate DMSO Control (-): | 0.4414±0.01397 | Plate Z-Factor: | 0.8920 |
| png ps pdf |
5743899 |
7,8a-dimethyl-3-prop-1-en-2-yl-2,3,4,4a,5,8-hexahydro-1H-naphthalen-1-ol |
5744139 |
(8,8-dimethyl-2,3,5,6,7,8a-hexahydro-1H-naphthalen-2-yl)methanol |
6097621 |
(2S)-6-methyl-2-(4-methyl-1-cyclohex-3-enyl)hept-5-en-2-ol |
6424423 |
n/a |
6428325 |
(4S)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
6428423 |
(1R,4S)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
active | Cluster 783 | Additional Members: 1 | Rows returned: 0 | |
|