| Compound Information | SONAR Target prediction | | Name: | CADIN-4-EN-10-OL | | Unique Identifier: | SPE00300055 | | MolClass: | Checkout models in ver1.5 and ver1.0 | | Molecular Formula: | | | Molecular Weight: | 196.16 g/mol | | X log p: | 2.173 (online calculus) | | Lipinksi Failures | 0 | | TPSA | 0 | | Hydrogen Bond Donor Count: | 0 | | Hydrogen Bond Acceptors Count: | 1 | | Rotatable Bond Count: | 1 | | Canonical Smiles: | CC(C)C1CCC(C)(O)C2CCC(C)=CC12 | | Class: | sesquiterpene | | Source: | Chamaecyparis spp and Juniperus spp. | | Reference: | Tet Lett 1968: 1913 |
| Species: |
4932 |
| Condition: |
YPT6 |
| Replicates: |
2 |
| Raw OD Value: r im |
0.3016±0.00742462 |
| Normalized OD Score: sc h |
0.8103±0.00125616 |
| Z-Score: |
-5.3092±0.0426188 |
| p-Value: |
0.000000111587 |
| Z-Factor: |
0.487134 |
| Fitness Defect: |
16.0085 |
| Bioactivity Statement: |
Active |
| Experimental Conditions | | | Library: | Spectrum | | Plate Number and Position: | 3|A10 | | Drug Concentration: | 50.00 nM | | OD Absorbance: | 600 nm | | Robot Temperature: | 25.80 Celcius | | Date: | 2006-02-22 YYYY-MM-DD | | Plate CH Control (+): | 0.040875±0.00108 | | Plate DMSO Control (-): | 0.33375±0.01630 | | Plate Z-Factor: | 0.7447 |
|  png
ps
pdf |
| 3084311 |
(1R,4S,4aR,8aS)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
| 3084331 |
(1S,4S,4aR,8aS)-1,6-dimethyl-4-propan-2-yl-3,4,4a,7,8,8a-hexahydro-2H-naphthalen-1-ol |
| 3085478 |
(1R)-1-[(1R,2S)-2,4-dimethyl-1-cyclohex-3-enyl]pentan-1-ol |
| 3098036 |
(3,8,8-trimethyl-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-yl)methanol |
| 3357659 |
10,13-dimethyl-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthrene-3,17-diol |
| 3504252 |
2,6,6,9-tetramethylbicyclo[5.4.0]undec-8-en-2-ol |
| internal high similarity DBLink | Rows returned: 9 | 1 2 Next >> |
| active | Cluster 783 | Additional Members: 1 | Rows returned: 0 | |
|
